C14H21N3O — CID 22478507
1-methyl-4-[5-[(E)-prop-1-enoxy]-3-pyridinyl]-1,4-diazepane (PubChem CID 22478507) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-methyl-4-[5-[(E)-prop-1-enoxy]-3-pyridinyl]-1,4-diazepane.
| Compound Name | 1-methyl-4-[5-[(E)-prop-1-enoxy]-3-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 22478507 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-methyl-4-[5-[(E)-prop-1-enoxy]-3-pyridinyl]-1,4-diazepane |
| SMILES | C/C=C/Oc1cncc(N2CCCN(C)CC2)c1 |
| InChI | InChI=1S/C14H21N3O/c1-3-9-18-14-10-13(11-15-12-14)17-6-4-5-16(2)7-8-17/h3,9-12H,4-8H2,1-2H3/b9-3+ |
| InChIKey | JIBFBGXLOUBKTN-YCRREMRBSA-N |
| XLogP | 2.14 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|