C16H11N3O2 — CID 22479843
3-(1-benzofuran-2-yl)-1H-indazole-5-carboxamide (PubChem CID 22479843) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-1H-indazole-5-carboxamide.
| Compound Name | 3-(1-benzofuran-2-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 22479843 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-1H-indazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]nc(-c3cc4ccccc4o3)c2c1 |
| InChI | InChI=1S/C16H11N3O2/c17-16(20)10-5-6-12-11(7-10)15(19-18-12)14-8-9-3-1-2-4-13(9)21-14/h1-8H,(H2,17,20)(H,18,19) |
| InChIKey | WQTOOEOWKUFFOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |