C21H23N4O2+ — CID 142112571
3-[[3-(1-benzofuran-2-yl)-1H-indazole-5-carbonyl]amino]propyl-dimethylazanium (PubChem CID 142112571) has the molecular formula C21H23N4O2+ and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[[3-(1-benzofuran-2-yl)-1H-indazole-5-carbonyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3-(1-benzofuran-2-yl)-1H-indazole-5-carbonyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 142112571 |
| Molecular Formula | C21H23N4O2+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[[3-(1-benzofuran-2-yl)-1H-indazole-5-carbonyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)c1ccc2[nH]nc(-c3cc4ccccc4o3)c2c1 |
| InChI | InChI=1S/C21H22N4O2/c1-25(2)11-5-10-22-21(26)15-8-9-17-16(12-15)20(24-23-17)19-13-14-6-3-4-7-18(14)27-19/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,26)(H,23,24)/p+1 |
| InChIKey | XTIZXQIPSCVWSA-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|