C22H16FN3O2S — CID 23589715
3-(1-benzofuran-2-yl)-4-fluoro-N-(2-thiophen-2-ylethyl)-1H-indazole-5-carboxamide (PubChem CID 23589715) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-4-fluoro-N-(2-thiophen-2-ylethyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-(1-benzofuran-2-yl)-4-fluoro-N-(2-thiophen-2-ylethyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 23589715 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-4-fluoro-N-(2-thiophen-2-ylethyl)-1H-indazole-5-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1ccc2[nH]nc(-c3cc4ccccc4o3)c2c1F |
| InChI | InChI=1S/C22H16FN3O2S/c23-20-15(22(27)24-10-9-14-5-3-11-29-14)7-8-16-19(20)21(26-25-16)18-12-13-4-1-2-6-17(13)28-18/h1-8,11-12H,9-10H2,(H,24,27)(H,25,26) |
| InChIKey | GFFBYEFMLNAWTP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |