C20H20N6O — CID 171830421
N-[2-(methylamino)ethyl]-3-(5-phenyl-1H-imidazol-2-yl)-1H-indazole-5-carboxamide (PubChem CID 171830421) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-(5-phenyl-1H-imidazol-2-yl)-1H-indazole-5-carboxamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-(5-phenyl-1H-imidazol-2-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 171830421 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-(5-phenyl-1H-imidazol-2-yl)-1H-indazole-5-carboxamide |
| SMILES | CNCCNC(=O)c1ccc2[nH]nc(-c3ncc(-c4ccccc4)[nH]3)c2c1 |
| InChI | InChI=1S/C20H20N6O/c1-21-9-10-22-20(27)14-7-8-16-15(11-14)18(26-25-16)19-23-12-17(24-19)13-5-3-2-4-6-13/h2-8,11-12,21H,9-10H2,1H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | RMTICEBZFBMIPO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|