C20H22FN3O2 — CID 175236372
3-(3-fluorophenyl)-N-(5-hydroxy-3-methylpentyl)-1H-indazole-5-carboxamide (PubChem CID 175236372) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(5-hydroxy-3-methylpentyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(5-hydroxy-3-methylpentyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 175236372 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(5-hydroxy-3-methylpentyl)-1H-indazole-5-carboxamide |
| SMILES | CC(CCO)CCNC(=O)c1ccc2[nH]nc(-c3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C20H22FN3O2/c1-13(8-10-25)7-9-22-20(26)15-5-6-18-17(12-15)19(24-23-18)14-3-2-4-16(21)11-14/h2-6,11-13,25H,7-10H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ZXJYDGJQBKJYRU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |