C22H18FN3O2 — CID 174425958
N-(6-ethenyl-1-hydroxycyclohexa-2,4-dien-1-yl)-3-(3-fluorophenyl)-1H-indazole-5-carboxamide (PubChem CID 174425958) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-(6-ethenyl-1-hydroxycyclohexa-2,4-dien-1-yl)-3-(3-fluorophenyl)-1H-indazole-5-carboxamide.
| Compound Name | N-(6-ethenyl-1-hydroxycyclohexa-2,4-dien-1-yl)-3-(3-fluorophenyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 174425958 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(6-ethenyl-1-hydroxycyclohexa-2,4-dien-1-yl)-3-(3-fluorophenyl)-1H-indazole-5-carboxamide |
| SMILES | C=CC1C=CC=CC1(O)NC(=O)c1ccc2[nH]nc(-c3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C22H18FN3O2/c1-2-16-7-3-4-11-22(16,28)24-21(27)15-9-10-19-18(13-15)20(26-25-19)14-6-5-8-17(23)12-14/h2-13,16,28H,1H2,(H,24,27)(H,25,26) |
| InChIKey | BWIVOBNHMVIVCZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|