C18H19FN4O2 — CID 135617784
N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-6-hydroxy-1H-indazole-5-carboxamide (PubChem CID 135617784) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-6-hydroxy-1H-indazole-5-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-6-hydroxy-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 135617784 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(3-fluorophenyl)-6-hydroxy-1H-indazole-5-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc2c(-c3cccc(F)c3)n[nH]c2cc1O |
| InChI | InChI=1S/C18H19FN4O2/c1-23(2)7-6-20-18(25)14-9-13-15(10-16(14)24)21-22-17(13)11-4-3-5-12(19)8-11/h3-5,8-10,24H,6-7H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | KAPXSYVCABIXGG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |