C16H15I2NO — CID 22483313
N-[1-(2,4-diiodophenyl)ethyl]-1-(4-methoxyphenyl)methanimine (PubChem CID 22483313) has the molecular formula C16H15I2NO and a molecular weight of 491.11 g/mol. Its IUPAC name is N-[1-(2,4-diiodophenyl)ethyl]-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-[1-(2,4-diiodophenyl)ethyl]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 22483313 |
| Molecular Formula | C16H15I2NO |
| Molecular Weight | 491.11 g/mol |
| Exact Mass | 490.92 |
| IUPAC Name | N-[1-(2,4-diiodophenyl)ethyl]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/C(C)c2ccc(I)cc2I)cc1 |
| InChI | InChI=1S/C16H15I2NO/c1-11(15-8-5-13(17)9-16(15)18)19-10-12-3-6-14(20-2)7-4-12/h3-11H,1-2H3/b19-10+ |
| InChIKey | YINMFYFXJJQNGJ-VXLYETTFSA-N |
| XLogP | 5.08 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.11 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|