C18H18Cl3N — CID 22483328
1-(4-propan-2-ylphenyl)-N-[1-(2,4,6-trichlorophenyl)ethyl]methanimine (PubChem CID 22483328) has the molecular formula C18H18Cl3N and a molecular weight of 354.71 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-N-[1-(2,4,6-trichlorophenyl)ethyl]methanimine.
| Compound Name | 1-(4-propan-2-ylphenyl)-N-[1-(2,4,6-trichlorophenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 22483328 |
| Molecular Formula | C18H18Cl3N |
| Molecular Weight | 354.71 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-N-[1-(2,4,6-trichlorophenyl)ethyl]methanimine |
| SMILES | CC(C)c1ccc(/C=N/C(C)c2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl3N/c1-11(2)14-6-4-13(5-7-14)10-22-12(3)18-16(20)8-15(19)9-17(18)21/h4-12H,1-3H3/b22-10+ |
| InChIKey | OOQPHSGNKVRLCD-LSHDLFTRSA-N |
| XLogP | 6.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|