C12H14N4 — CID 5403379
(Z)-1-(4-propan-2-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5403379) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is (Z)-1-(4-propan-2-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(4-propan-2-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5403379 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (Z)-1-(4-propan-2-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CC(C)c1ccc(/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C12H14N4/c1-10(2)12-5-3-11(4-6-12)7-15-16-8-13-14-9-16/h3-10H,1-2H3/b15-7- |
| InChIKey | MHZVCDJGINXKCH-CHHVJCJISA-N |
| XLogP | 2.28 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|