C11H12N4 — CID 5402317
(Z)-1-(4-ethylphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5402317) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is (Z)-1-(4-ethylphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(4-ethylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5402317 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (Z)-1-(4-ethylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | CCc1ccc(/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C11H12N4/c1-2-10-3-5-11(6-4-10)7-14-15-8-12-13-9-15/h3-9H,2H2,1H3/b14-7- |
| InChIKey | AQCNDIUVPKLJMW-AUWJEWJLSA-N |
| XLogP | 1.72 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|