C10H10N4 — CID 5410104
(E)-1-phenyl-N-(1,2,4-triazol-4-yl)ethanimine (PubChem CID 5410104) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is (E)-1-phenyl-N-(1,2,4-triazol-4-yl)ethanimine.
| Compound Name | (E)-1-phenyl-N-(1,2,4-triazol-4-yl)ethanimine |
|---|---|
| PubChem CID | 5410104 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (E)-1-phenyl-N-(1,2,4-triazol-4-yl)ethanimine |
| SMILES | C/C(=N\n1cnnc1)c1ccccc1 |
| InChI | InChI=1S/C10H10N4/c1-9(10-5-3-2-4-6-10)13-14-7-11-12-8-14/h2-8H,1H3/b13-9+ |
| InChIKey | HWPMKZSAYRLELT-UKTHLTGXSA-N |
| XLogP | 1.55 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|