About dipotassium;(2-aminoacetyl) phosphate
dipotassium;(2-aminoacetyl) phosphate (PubChem CID 22483641) has the molecular formula C2H4K2NO5P
and a molecular weight of 231.23 g/mol. Its IUPAC name is dipotassium;(2-aminoacetyl) phosphate.
Molecular Properties
| Compound Name | dipotassium;(2-aminoacetyl) phosphate |
| PubChem CID | 22483641 |
| Molecular Formula | C2H4K2NO5P |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 230.91 |
| IUPAC Name | dipotassium;(2-aminoacetyl) phosphate |
| SMILES | NCC(=O)OP(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C2H6NO5P.2K/c3-1-2(4)8-9(5,6)7;;/h1,3H2,(H2,5,6,7);;/q;2*+1/p-2 |
| InChIKey | IFIBVINLPDZWKV-UHFFFAOYSA-L |
| XLogP | -8.68 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;(2-aminoacetyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;(2-aminoacetyl) phosphate?
The IUPAC name of dipotassium;(2-aminoacetyl) phosphate (CID 22483641) is dipotassium;(2-aminoacetyl) phosphate.
What is the SMILES notation for dipotassium;(2-aminoacetyl) phosphate?
The canonical SMILES for dipotassium;(2-aminoacetyl) phosphate is NCC(=O)OP(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;(2-aminoacetyl) phosphate?
The InChIKey is IFIBVINLPDZWKV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H6NO5P.2K/c3-1-2(4)8-9(5,6)7;;/h1,3H2,(H2,5,6,7);;/q;2*+1/p-2.
What are the key properties of dipotassium;(2-aminoacetyl) phosphate?
dipotassium;(2-aminoacetyl) phosphate has a molecular weight of 231.23 g/mol, XLogP of -8.68, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;(2-aminoacetyl) phosphate is sourced from PubChem (CID 22483641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).