C7H20N4O8P2 — CID 175759934
(2-aminoacetyl)oxyphosphonamidic acid;[(2S)-2-amino-3-methylbutanoyl]oxyphosphonamidic acid (PubChem CID 175759934) has the molecular formula C7H20N4O8P2 and a molecular weight of 350.21 g/mol. Its IUPAC name is (2-aminoacetyl)oxyphosphonamidic acid;[(2S)-2-amino-3-methylbutanoyl]oxyphosphonamidic acid.
| Compound Name | (2-aminoacetyl)oxyphosphonamidic acid;[(2S)-2-amino-3-methylbutanoyl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 175759934 |
| Molecular Formula | C7H20N4O8P2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2-aminoacetyl)oxyphosphonamidic acid;[(2S)-2-amino-3-methylbutanoyl]oxyphosphonamidic acid |
| SMILES | CC(C)[C@H](N)C(=O)OP(N)(=O)O.NCC(=O)OP(N)(=O)O |
| InChI | InChI=1S/C5H13N2O4P.C2H7N2O4P/c1-3(2)4(6)5(8)11-12(7,9)10;3-1-2(5)8-9(4,6)7/h3-4H,6H2,1-2H3,(H3,7,9,10);1,3H2,(H3,4,6,7)/t4-;/m0./s1 |
| InChIKey | AZPKNYLXFDIACL-WCCKRBBISA-N |
| XLogP | -1.88 |
| TPSA | 231.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|