C14H21NS — CID 22486376
2-phenylsulfanyl-N-propylcyclopentan-1-amine (PubChem CID 22486376) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-propylcyclopentan-1-amine.
| Compound Name | 2-phenylsulfanyl-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 22486376 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-phenylsulfanyl-N-propylcyclopentan-1-amine |
| SMILES | CCCNC1CCCC1Sc1ccccc1 |
| InChI | InChI=1S/C14H21NS/c1-2-11-15-13-9-6-10-14(13)16-12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3 |
| InChIKey | RLQJNBNEFCTZNP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |