C17H26BrNS — CID 64614544
2-(2-bromophenyl)sulfanyl-N-propylcyclooctan-1-amine (PubChem CID 64614544) has the molecular formula C17H26BrNS and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-N-propylcyclooctan-1-amine.
| Compound Name | 2-(2-bromophenyl)sulfanyl-N-propylcyclooctan-1-amine |
|---|---|
| PubChem CID | 64614544 |
| Molecular Formula | C17H26BrNS |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-N-propylcyclooctan-1-amine |
| SMILES | CCCNC1CCCCCCC1Sc1ccccc1Br |
| InChI | InChI=1S/C17H26BrNS/c1-2-13-19-15-10-5-3-4-6-12-17(15)20-16-11-8-7-9-14(16)18/h7-9,11,15,17,19H,2-6,10,12-13H2,1H3 |
| InChIKey | HDAIATNRFUVOPG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |