C12H33NO3Si3 — CID 22491513
1-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 22491513) has the molecular formula C12H33NO3Si3 and a molecular weight of 323.66 g/mol. Its IUPAC name is 1-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine.
| Compound Name | 1-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 22491513 |
| Molecular Formula | C12H33NO3Si3 |
| Molecular Weight | 323.66 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CCC(N([Si](C)(C)C)[Si](C)(C)C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H33NO3Si3/c1-11-12(19(14-2,15-3)16-4)13(17(5,6)7)18(8,9)10/h12H,11H2,1-10H3 |
| InChIKey | KQQASGHPGFTUKH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|