C24H22FNO5 — CID 22493648
2-[[4-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]cyclopent-2-en-1-yl]oxymethyl]-6-methylbenzoic acid (PubChem CID 22493648) has the molecular formula C24H22FNO5 and a molecular weight of 423.44 g/mol. Its IUPAC name is 2-[[4-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]cyclopent-2-en-1-yl]oxymethyl]-6-methylbenzoic acid.
| Compound Name | 2-[[4-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]cyclopent-2-en-1-yl]oxymethyl]-6-methylbenzoic acid |
|---|---|
| PubChem CID | 22493648 |
| Molecular Formula | C24H22FNO5 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[[4-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]cyclopent-2-en-1-yl]oxymethyl]-6-methylbenzoic acid |
| SMILES | Cc1cccc(COC2C=CC(OCc3coc(-c4ccc(F)cc4)n3)C2)c1C(=O)O |
| InChI | InChI=1S/C24H22FNO5/c1-15-3-2-4-17(22(15)24(27)28)12-29-20-9-10-21(11-20)30-13-19-14-31-23(26-19)16-5-7-18(25)8-6-16/h2-10,14,20-21H,11-13H2,1H3,(H,27,28) |
| InChIKey | WEEBNVABHSINEF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|