C10H13NO — CID 22495
Indol-4(5H)-one, 6,7-dihydro-2,3-dimethyl- (PubChem CID 22495) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,3-dimethyl-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | Indol-4(5H)-one, 6,7-dihydro-2,3-dimethyl- |
|---|---|
| PubChem CID | 22495 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2,3-dimethyl-1,5,6,7-tetrahydroindol-4-one |
| SMILES | CC1=C(NC2=C1C(=O)CCC2)C |
| InChI | InChI=1S/C10H13NO/c1-6-7(2)11-8-4-3-5-9(12)10(6)8/h11H,3-5H2,1-2H3 |
| InChIKey | UORPHFZBCZEBJV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 202 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |