C10H17NS2 — CID 22495240
propyl N,N-bis(prop-2-enyl)carbamodithioate (PubChem CID 22495240) has the molecular formula C10H17NS2 and a molecular weight of 215.39 g/mol. Its IUPAC name is propyl N,N-bis(prop-2-enyl)carbamodithioate.
| Compound Name | propyl N,N-bis(prop-2-enyl)carbamodithioate |
|---|---|
| PubChem CID | 22495240 |
| Molecular Formula | C10H17NS2 |
| Molecular Weight | 215.39 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | propyl N,N-bis(prop-2-enyl)carbamodithioate |
| SMILES | C=CCN(CC=C)C(=S)SCCC |
| InChI | InChI=1S/C10H17NS2/c1-4-7-11(8-5-2)10(12)13-9-6-3/h4-5H,1-2,6-9H2,3H3 |
| InChIKey | HWFJVTZDRBYXSK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|