C27H22F2N2O — CID 2249543
1-[(S)-(2-fluorophenyl)-phenylmethyl]-3-[(R)-(2-fluorophenyl)-phenylmethyl]urea (PubChem CID 2249543) has the molecular formula C27H22F2N2O and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-[(S)-(2-fluorophenyl)-phenylmethyl]-3-[(R)-(2-fluorophenyl)-phenylmethyl]urea.
| Compound Name | 1-[(S)-(2-fluorophenyl)-phenylmethyl]-3-[(R)-(2-fluorophenyl)-phenylmethyl]urea |
|---|---|
| PubChem CID | 2249543 |
| Molecular Formula | C27H22F2N2O |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(S)-(2-fluorophenyl)-phenylmethyl]-3-[(R)-(2-fluorophenyl)-phenylmethyl]urea |
| SMILES | O=C(N[C@H](c1ccccc1)c1ccccc1F)N[C@@H](c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C27H22F2N2O/c28-23-17-9-7-15-21(23)25(19-11-3-1-4-12-19)30-27(32)31-26(20-13-5-2-6-14-20)22-16-8-10-18-24(22)29/h1-18,25-26H,(H2,30,31,32)/t25-,26+ |
| InChIKey | CYAWVJMZJCGYDV-WMPKNSHKSA-N |
| XLogP | 6.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |