C23H29Cl2N3O2 — CID 22502852
3-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)isoquinoline;dihydrochloride (PubChem CID 22502852) has the molecular formula C23H29Cl2N3O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)isoquinoline;dihydrochloride.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 22502852 |
| Molecular Formula | C23H29Cl2N3O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)isoquinoline;dihydrochloride |
| SMILES | CCN1CCN(c2nc(-c3ccc(OC)c(OC)c3)cc3ccccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C23H27N3O2.2ClH/c1-4-25-11-13-26(14-12-25)23-19-8-6-5-7-17(19)15-20(24-23)18-9-10-21(27-2)22(16-18)28-3;;/h5-10,15-16H,4,11-14H2,1-3H3;2*1H |
| InChIKey | YANGGAFPMVXCSH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |