C26H33ClN4O — CID 22503347
N-[[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]methyl]butanamide;hydrochloride (PubChem CID 22503347) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is N-[[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]methyl]butanamide;hydrochloride.
| Compound Name | N-[[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 22503347 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]methyl]butanamide;hydrochloride |
| SMILES | CCCC(=O)NCc1ccc(-c2cc3ccccc3c(N3CCN(CC)CC3)n2)cc1.Cl |
| InChI | InChI=1S/C26H32N4O.ClH/c1-3-7-25(31)27-19-20-10-12-21(13-11-20)24-18-22-8-5-6-9-23(22)26(28-24)30-16-14-29(4-2)15-17-30;/h5-6,8-13,18H,3-4,7,14-17,19H2,1-2H3,(H,27,31);1H |
| InChIKey | WEMXKPKCDVYBHM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |