C24H28N4O2 — CID 20720257
[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl] N-ethylcarbamate (PubChem CID 20720257) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl] N-ethylcarbamate.
| Compound Name | [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 20720257 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(-c2cc3ccccc3c(N3CCN(CC)CC3)n2)cc1 |
| InChI | InChI=1S/C24H28N4O2/c1-3-25-24(29)30-20-11-9-18(10-12-20)22-17-19-7-5-6-8-21(19)23(26-22)28-15-13-27(4-2)14-16-28/h5-12,17H,3-4,13-16H2,1-2H3,(H,25,29) |
| InChIKey | MNWGGQIYLJJNGY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |