C24H29Cl2N3O — CID 22503021
1-(4-ethylpiperazin-1-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]isoquinoline;dihydrochloride (PubChem CID 22503021) has the molecular formula C24H29Cl2N3O and a molecular weight of 446.42 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]isoquinoline;dihydrochloride.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 22503021 |
| Molecular Formula | C24H29Cl2N3O |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]isoquinoline;dihydrochloride |
| SMILES | CCN1CCN(c2nc(/C=C/c3ccc(OC)cc3)cc3ccccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C24H27N3O.2ClH/c1-3-26-14-16-27(17-15-26)24-23-7-5-4-6-20(23)18-21(25-24)11-8-19-9-12-22(28-2)13-10-19;;/h4-13,18H,3,14-17H2,1-2H3;2*1H/b11-8+;; |
| InChIKey | APZAQOCWWIMJFK-OHENRDTHSA-N |
| XLogP | 5.40 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |