C16H17ClN6O2S — CID 22505993
4-(2-aminoethylamino)-2-[(3-chloro-4-methoxyphenyl)methylsulfanyl]-8H-pteridin-7-one (PubChem CID 22505993) has the molecular formula C16H17ClN6O2S and a molecular weight of 392.87 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-2-[(3-chloro-4-methoxyphenyl)methylsulfanyl]-8H-pteridin-7-one.
| Compound Name | 4-(2-aminoethylamino)-2-[(3-chloro-4-methoxyphenyl)methylsulfanyl]-8H-pteridin-7-one |
|---|---|
| PubChem CID | 22505993 |
| Molecular Formula | C16H17ClN6O2S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-(2-aminoethylamino)-2-[(3-chloro-4-methoxyphenyl)methylsulfanyl]-8H-pteridin-7-one |
| SMILES | COc1ccc(CSc2nc(NCCN)c3ncc(=O)[nH]c3n2)cc1Cl |
| InChI | InChI=1S/C16H17ClN6O2S/c1-25-11-3-2-9(6-10(11)17)8-26-16-22-14(19-5-4-18)13-15(23-16)21-12(24)7-20-13/h2-3,6-7H,4-5,8,18H2,1H3,(H2,19,21,22,23,24) |
| InChIKey | INAJFJAOCLCRBN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |