C26H31N3O2 — CID 22509217
3-benzyl-6-[3-(3,4-dimethoxyphenyl)prop-2-ynyl]-1-methyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine (PubChem CID 22509217) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-benzyl-6-[3-(3,4-dimethoxyphenyl)prop-2-ynyl]-1-methyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine.
| Compound Name | 3-benzyl-6-[3-(3,4-dimethoxyphenyl)prop-2-ynyl]-1-methyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 22509217 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-benzyl-6-[3-(3,4-dimethoxyphenyl)prop-2-ynyl]-1-methyl-4,5,7,8-tetrahydro-2H-pyrido[4,3-d]pyrimidine |
| SMILES | COc1ccc(C#CCN2CCC3=C(C2)CN(Cc2ccccc2)CN3C)cc1OC |
| InChI | InChI=1S/C26H31N3O2/c1-27-20-29(17-22-8-5-4-6-9-22)19-23-18-28(15-13-24(23)27)14-7-10-21-11-12-25(30-2)26(16-21)31-3/h4-6,8-9,11-12,16H,13-15,17-20H2,1-3H3 |
| InChIKey | KPKFYYXLASSEEG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|