C16H23N5O2S — CID 22509881
1-[5-(dipropylamino)-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)urea (PubChem CID 22509881) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[5-(dipropylamino)-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[5-(dipropylamino)-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 22509881 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[5-(dipropylamino)-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)urea |
| SMILES | CCCN(CCC)c1nnc(NC(=O)Nc2ccccc2OC)s1 |
| InChI | InChI=1S/C16H23N5O2S/c1-4-10-21(11-5-2)16-20-19-15(24-16)18-14(22)17-12-8-6-7-9-13(12)23-3/h6-9H,4-5,10-11H2,1-3H3,(H2,17,18,19,22) |
| InChIKey | GCAKMJFFICWCMD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |