About N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine
N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine (PubChem CID 2250996) has the molecular formula C16H25Cl2NO
and a molecular weight of 318.29 g/mol. Its IUPAC name is N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine.
Molecular Properties
| Compound Name | N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine |
| PubChem CID | 2250996 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine |
| SMILES | CCCCNCCCCCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H25Cl2NO/c1-2-3-11-19-12-6-4-5-7-13-20-15-10-8-9-14(17)16(15)18/h8-10,19H,2-7,11-13H2,1H3 |
| InChIKey | FIUPKIYTSOOCBA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine?
The IUPAC name of N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine (CID 2250996) is N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine.
What is the SMILES notation for N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine?
The canonical SMILES for N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine is CCCCNCCCCCCOc1cccc(Cl)c1Cl.
What is the InChIKey of N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine?
The InChIKey is FIUPKIYTSOOCBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl2NO/c1-2-3-11-19-12-6-4-5-7-13-20-15-10-8-9-14(17)16(15)18/h8-10,19H,2-7,11-13H2,1H3.
What are the key properties of N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine?
N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine has a molecular weight of 318.29 g/mol, XLogP of 5.32, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-(2,3-dichlorophenoxy)hexan-1-amine is sourced from PubChem (CID 2250996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).