C17H16ClN3O4 — CID 22510511
5-chloro-N-(3,4,5-trimethoxyphenyl)indazole-1-carboxamide (PubChem CID 22510511) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 5-chloro-N-(3,4,5-trimethoxyphenyl)indazole-1-carboxamide.
| Compound Name | 5-chloro-N-(3,4,5-trimethoxyphenyl)indazole-1-carboxamide |
|---|---|
| PubChem CID | 22510511 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 5-chloro-N-(3,4,5-trimethoxyphenyl)indazole-1-carboxamide |
| SMILES | COc1cc(NC(=O)n2ncc3cc(Cl)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C17H16ClN3O4/c1-23-14-7-12(8-15(24-2)16(14)25-3)20-17(22)21-13-5-4-11(18)6-10(13)9-19-21/h4-9H,1-3H3,(H,20,22) |
| InChIKey | SSDJCZIBCLOZNO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |