C16H14ClN3O3 — CID 22510623
5-chloro-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide (PubChem CID 22510623) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide.
| Compound Name | 5-chloro-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide |
|---|---|
| PubChem CID | 22510623 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-chloro-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide |
| SMILES | COc1ccc(NC(=O)n2ncc3cc(Cl)ccc32)cc1OC |
| InChI | InChI=1S/C16H14ClN3O3/c1-22-14-6-4-12(8-15(14)23-2)19-16(21)20-13-5-3-11(17)7-10(13)9-18-20/h3-9H,1-2H3,(H,19,21) |
| InChIKey | ILTWCHQHEZAJRM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |