C16H16N4O3 — CID 25197779
3-amino-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide (PubChem CID 25197779) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide.
| Compound Name | 3-amino-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide |
|---|---|
| PubChem CID | 25197779 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-amino-N-(3,4-dimethoxyphenyl)indazole-1-carboxamide |
| SMILES | COc1ccc(NC(=O)n2nc(N)c3ccccc32)cc1OC |
| InChI | InChI=1S/C16H16N4O3/c1-22-13-8-7-10(9-14(13)23-2)18-16(21)20-12-6-4-3-5-11(12)15(17)19-20/h3-9H,1-2H3,(H2,17,19)(H,18,21) |
| InChIKey | NOJNFWLYVSIILI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |