C16H14F2N4O2 — CID 2811425
1-(2,4-difluorophenyl)-3-(4-methoxy-1-methylindazol-3-yl)urea (PubChem CID 2811425) has the molecular formula C16H14F2N4O2 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-methoxy-1-methylindazol-3-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-methoxy-1-methylindazol-3-yl)urea |
|---|---|
| PubChem CID | 2811425 |
| Molecular Formula | C16H14F2N4O2 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-methoxy-1-methylindazol-3-yl)urea |
| SMILES | COc1cccc2c1c(NC(=O)Nc1ccc(F)cc1F)nn2C |
| InChI | InChI=1S/C16H14F2N4O2/c1-22-12-4-3-5-13(24-2)14(12)15(21-22)20-16(23)19-11-7-6-9(17)8-10(11)18/h3-8H,1-2H3,(H2,19,20,21,23) |
| InChIKey | GWZUXEHEAITRAE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |