C22H25N5O3S2 — CID 22510635
ethyl 2-[[5-[benzyl(methyl)amino]-1,3,4-thiadiazol-2-yl]carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 22510635) has the molecular formula C22H25N5O3S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is ethyl 2-[[5-[benzyl(methyl)amino]-1,3,4-thiadiazol-2-yl]carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[5-[benzyl(methyl)amino]-1,3,4-thiadiazol-2-yl]carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 22510635 |
| Molecular Formula | C22H25N5O3S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | ethyl 2-[[5-[benzyl(methyl)amino]-1,3,4-thiadiazol-2-yl]carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Nc2nnc(N(C)Cc3ccccc3)s2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H25N5O3S2/c1-3-30-19(28)17-15-11-7-8-12-16(15)31-18(17)23-20(29)24-21-25-26-22(32-21)27(2)13-14-9-5-4-6-10-14/h4-6,9-10H,3,7-8,11-13H2,1-2H3,(H2,23,24,25,29) |
| InChIKey | GIBXFERXPPWQBH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |