C28H35N3O2S — CID 22514806
10-(2,5-dimethylphenyl)-4-ethyl-11-methyl-N-(4-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 22514806) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 10-(2,5-dimethylphenyl)-4-ethyl-11-methyl-N-(4-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | 10-(2,5-dimethylphenyl)-4-ethyl-11-methyl-N-(4-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 22514806 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 10-(2,5-dimethylphenyl)-4-ethyl-11-methyl-N-(4-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCc1cc2c(cc3n2CC(C)(C(=O)NC2CCC(C)CC2)N(c2cc(C)ccc2C)C3=O)s1 |
| InChI | InChI=1S/C28H35N3O2S/c1-6-21-14-23-25(34-21)15-24-26(32)31(22-13-18(3)7-10-19(22)4)28(5,16-30(23)24)27(33)29-20-11-8-17(2)9-12-20/h7,10,13-15,17,20H,6,8-9,11-12,16H2,1-5H3,(H,29,33) |
| InChIKey | MCZZQUNPYBCHTA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |