C21H17BrN2O5 — CID 2251529
(5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-(4-propan-2-ylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2251529) has the molecular formula C21H17BrN2O5 and a molecular weight of 457.28 g/mol. Its IUPAC name is (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-(4-propan-2-ylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-(4-propan-2-ylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2251529 |
| Molecular Formula | C21H17BrN2O5 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (5E)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1-(4-propan-2-ylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)c1ccc(N2C(=O)NC(=O)/C(=C\c3cc4c(cc3Br)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C21H17BrN2O5/c1-11(2)12-3-5-14(6-4-12)24-20(26)15(19(25)23-21(24)27)7-13-8-17-18(9-16(13)22)29-10-28-17/h3-9,11H,10H2,1-2H3,(H,23,25,27)/b15-7+ |
| InChIKey | GZNXVPJIYWBSJV-VIZOYTHASA-N |
| XLogP | 3.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|