C24H26N2O3 — CID 22515493
2-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethoxyphenyl)-2-oxoacetamide (PubChem CID 22515493) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 22515493 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethoxyphenyl)-2-oxoacetamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)c2cc(C)n(-c3cc(C)ccc3C)c2C)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-6-29-20-11-9-19(10-12-20)25-24(28)23(27)21-14-17(4)26(18(21)5)22-13-15(2)7-8-16(22)3/h7-14H,6H2,1-5H3,(H,25,28) |
| InChIKey | BOWIPZJRDYGVLM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|