C15H23BrN4O3S — CID 22516465
2-[(2-amino-5-bromo-3-pyridinyl)sulfonyl-methylamino]-N-(4-methylcyclohexyl)acetamide (PubChem CID 22516465) has the molecular formula C15H23BrN4O3S and a molecular weight of 419.35 g/mol. Its IUPAC name is 2-[(2-amino-5-bromo-3-pyridinyl)sulfonyl-methylamino]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-amino-5-bromo-3-pyridinyl)sulfonyl-methylamino]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 22516465 |
| Molecular Formula | C15H23BrN4O3S |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[(2-amino-5-bromo-3-pyridinyl)sulfonyl-methylamino]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)CN(C)S(=O)(=O)c2cc(Br)cnc2N)CC1 |
| InChI | InChI=1S/C15H23BrN4O3S/c1-10-3-5-12(6-4-10)19-14(21)9-20(2)24(22,23)13-7-11(16)8-18-15(13)17/h7-8,10,12H,3-6,9H2,1-2H3,(H2,17,18)(H,19,21) |
| InChIKey | VERQWKLGCSBANQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |