C19H19N5O3S — CID 22518441
2-[4-oxo-3-(oxolan-2-ylmethyl)pteridin-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 22518441) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[4-oxo-3-(oxolan-2-ylmethyl)pteridin-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[4-oxo-3-(oxolan-2-ylmethyl)pteridin-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 22518441 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[4-oxo-3-(oxolan-2-ylmethyl)pteridin-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSc1nc2nccnc2c(=O)n1CC1CCCO1)Nc1ccccc1 |
| InChI | InChI=1S/C19H19N5O3S/c25-15(22-13-5-2-1-3-6-13)12-28-19-23-17-16(20-8-9-21-17)18(26)24(19)11-14-7-4-10-27-14/h1-3,5-6,8-9,14H,4,7,10-12H2,(H,22,25) |
| InChIKey | MDGRPRJBCAGYKP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |