C18H15FN2O2 — CID 22520254
1-benzyl-4-[(3-fluorophenyl)methyl]pyrazine-2,3-dione (PubChem CID 22520254) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-benzyl-4-[(3-fluorophenyl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-benzyl-4-[(3-fluorophenyl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 22520254 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-benzyl-4-[(3-fluorophenyl)methyl]pyrazine-2,3-dione |
| SMILES | O=c1c(=O)n(Cc2cccc(F)c2)ccn1Cc1ccccc1 |
| InChI | InChI=1S/C18H15FN2O2/c19-16-8-4-7-15(11-16)13-21-10-9-20(17(22)18(21)23)12-14-5-2-1-3-6-14/h1-11H,12-13H2 |
| InChIKey | SVPQNRTVTBRQMC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|