C18H18N2O2 — CID 682107
1,4-dibenzylpiperazine-2,5-dione (PubChem CID 682107) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,4-dibenzylpiperazine-2,5-dione.
| Compound Name | 1,4-dibenzylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 682107 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1,4-dibenzylpiperazine-2,5-dione |
| SMILES | O=C1CN(Cc2ccccc2)C(=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c21-17-14-20(12-16-9-5-2-6-10-16)18(22)13-19(17)11-15-7-3-1-4-8-15/h1-10H,11-14H2 |
| InChIKey | IQRPFFBYORNALN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |