C29H37N3O3 — CID 22521925
N-cycloheptyl-4,11-dimethyl-9-oxo-10-(4-phenylbutan-2-yl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 22521925) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-cycloheptyl-4,11-dimethyl-9-oxo-10-(4-phenylbutan-2-yl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | N-cycloheptyl-4,11-dimethyl-9-oxo-10-(4-phenylbutan-2-yl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 22521925 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-cycloheptyl-4,11-dimethyl-9-oxo-10-(4-phenylbutan-2-yl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1cc2c(cc3n2CC(C)(C(=O)NC2CCCCCC2)N(C(C)CCc2ccccc2)C3=O)o1 |
| InChI | InChI=1S/C29H37N3O3/c1-20(15-16-22-11-7-6-8-12-22)32-27(33)25-18-26-24(17-21(2)35-26)31(25)19-29(32,3)28(34)30-23-13-9-4-5-10-14-23/h6-8,11-12,17-18,20,23H,4-5,9-10,13-16,19H2,1-3H3,(H,30,34) |
| InChIKey | BHYJSWXHCWFWID-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |