C26H31N3O3 — CID 92721537
(11S)-N-cycloheptyl-4,11-dimethyl-10-(4-methylphenyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92721537) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (11S)-N-cycloheptyl-4,11-dimethyl-10-(4-methylphenyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11S)-N-cycloheptyl-4,11-dimethyl-10-(4-methylphenyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92721537 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (11S)-N-cycloheptyl-4,11-dimethyl-10-(4-methylphenyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1ccc(N2C(=O)c3cc4oc(C)cc4n3C[C@@]2(C)C(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C26H31N3O3/c1-17-10-12-20(13-11-17)29-24(30)22-15-23-21(14-18(2)32-23)28(22)16-26(29,3)25(31)27-19-8-6-4-5-7-9-19/h10-15,19H,4-9,16H2,1-3H3,(H,27,31)/t26-/m0/s1 |
| InChIKey | NOUPIWQWGNSKBP-SANMLTNESA-N |
| XLogP | 5.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |