C25H35N3O3 — CID 92721556
(11R)-N-cycloheptyl-10-cyclohexyl-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92721556) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (11R)-N-cycloheptyl-10-cyclohexyl-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11R)-N-cycloheptyl-10-cyclohexyl-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92721556 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (11R)-N-cycloheptyl-10-cyclohexyl-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1cc2c(cc3n2C[C@](C)(C(=O)NC2CCCCCC2)N(C2CCCCC2)C3=O)o1 |
| InChI | InChI=1S/C25H35N3O3/c1-17-14-20-22(31-17)15-21-23(29)28(19-12-8-5-9-13-19)25(2,16-27(20)21)24(30)26-18-10-6-3-4-7-11-18/h14-15,18-19H,3-13,16H2,1-2H3,(H,26,30)/t25-/m1/s1 |
| InChIKey | JQQXAUXVJJXDFS-RUZDIDTESA-N |
| XLogP | 4.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |