C24H29N5O2 — CID 22522822
N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-pyrrolo[1,2-a]quinoxalin-4-ylpiperidine-4-carboxamide (PubChem CID 22522822) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-pyrrolo[1,2-a]quinoxalin-4-ylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-pyrrolo[1,2-a]quinoxalin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22522822 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-pyrrolo[1,2-a]quinoxalin-4-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C1CCN(c2nc3ccccc3n3cccc23)CC1 |
| InChI | InChI=1S/C24H29N5O2/c30-22-9-4-13-27(22)14-5-12-25-24(31)18-10-16-28(17-11-18)23-21-8-3-15-29(21)20-7-2-1-6-19(20)26-23/h1-3,6-8,15,18H,4-5,9-14,16-17H2,(H,25,31) |
| InChIKey | DTUBBTVEGPQFID-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|