C26H28N2O — CID 22525600
N-[[(1S,2R)-2-butylcyclopropyl]-(4-phenylphenyl)methyl]pyridine-3-carboxamide (PubChem CID 22525600) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[[(1S,2R)-2-butylcyclopropyl]-(4-phenylphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(1S,2R)-2-butylcyclopropyl]-(4-phenylphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22525600 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[[(1S,2R)-2-butylcyclopropyl]-(4-phenylphenyl)methyl]pyridine-3-carboxamide |
| SMILES | CCCC[C@@H]1C[C@@H]1C(NC(=O)c1cccnc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O/c1-2-3-8-22-17-24(22)25(28-26(29)23-11-7-16-27-18-23)21-14-12-20(13-15-21)19-9-5-4-6-10-19/h4-7,9-16,18,22,24-25H,2-3,8,17H2,1H3,(H,28,29)/t22-,24+,25?/m1/s1 |
| InChIKey | FTBXSQVMRIYSKN-JNLGJKASSA-N |
| XLogP | 6.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |