C10H11BrN2O2 — CID 145337212
N-[(2-bromocyclopropyl)-hydroxymethyl]pyridine-3-carboxamide (PubChem CID 145337212) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is N-[(2-bromocyclopropyl)-hydroxymethyl]pyridine-3-carboxamide.
| Compound Name | N-[(2-bromocyclopropyl)-hydroxymethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145337212 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | N-[(2-bromocyclopropyl)-hydroxymethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(O)C1CC1Br)c1cccnc1 |
| InChI | InChI=1S/C10H11BrN2O2/c11-8-4-7(8)10(15)13-9(14)6-2-1-3-12-5-6/h1-3,5,7-8,10,15H,4H2,(H,13,14) |
| InChIKey | VXVGSRYFKMPNDU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|