C18H18N4O3S — CID 22539115
6-(3,4-dimethylphenoxy)-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine (PubChem CID 22539115) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 6-(3,4-dimethylphenoxy)-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-(3,4-dimethylphenoxy)-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22539115 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 6-(3,4-dimethylphenoxy)-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(Oc2ncnc(NCCc3cccs3)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C18H18N4O3S/c1-12-5-6-14(10-13(12)2)25-18-16(22(23)24)17(20-11-21-18)19-8-7-15-4-3-9-26-15/h3-6,9-11H,7-8H2,1-2H3,(H,19,20,21) |
| InChIKey | CDCQWTJEBTUXDU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|