C16H15N5O4 — CID 22539179
4-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenoxy)-5-nitropyrimidine (PubChem CID 22539179) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenoxy)-5-nitropyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenoxy)-5-nitropyrimidine |
|---|---|
| PubChem CID | 22539179 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-6-(4-methoxyphenoxy)-5-nitropyrimidine |
| SMILES | COc1ccc(Oc2ncnc(-n3nc(C)cc3C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N5O4/c1-10-8-11(2)20(19-10)15-14(21(22)23)16(18-9-17-15)25-13-6-4-12(24-3)5-7-13/h4-9H,1-3H3 |
| InChIKey | ZLTVUYBWCIONCT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|